C13H18N4O2S2 — CID 103287107
5-amino-N-methyl-2-[1-(1,3-thiazol-2-yl)propylamino]benzenesulfonamide (PubChem CID 103287107) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 5-amino-N-methyl-2-[1-(1,3-thiazol-2-yl)propylamino]benzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-[1-(1,3-thiazol-2-yl)propylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 103287107 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 5-amino-N-methyl-2-[1-(1,3-thiazol-2-yl)propylamino]benzenesulfonamide |
| SMILES | CCC(Nc1ccc(N)cc1S(=O)(=O)NC)c1nccs1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-3-10(13-16-6-7-20-13)17-11-5-4-9(14)8-12(11)21(18,19)15-2/h4-8,10,15,17H,3,14H2,1-2H3 |
| InChIKey | CHBPZSOWFWCYDC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|