C13H14FN3O2S — CID 83207195
2-amino-3-fluoro-6-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid (PubChem CID 83207195) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-amino-3-fluoro-6-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid.
| Compound Name | 2-amino-3-fluoro-6-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid |
|---|---|
| PubChem CID | 83207195 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-amino-3-fluoro-6-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid |
| SMILES | CCC(Nc1ccc(F)c(N)c1C(=O)O)c1nccs1 |
| InChI | InChI=1S/C13H14FN3O2S/c1-2-8(12-16-5-6-20-12)17-9-4-3-7(14)11(15)10(9)13(18)19/h3-6,8,17H,2,15H2,1H3,(H,18,19) |
| InChIKey | LMUXKINXYKYCIR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|