2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid

C14H16N2O2S — CID 81282204

IUPAC2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid
SMILESCCC(Nc1ccc(C(=O)O)c(C)c1)c1nccs1
InChIInChI=1S/C14H16N2O2S/c1-3-12(13-15-6-7-19-13)16-10-4-5-11(14(17)18)9(2)8-10/h4-8,12,16H,3H2,1-2H3,(H,17,18)
InChIKeyPZCRFVRVMNRTJL-UHFFFAOYSA-N
MW276.36 g/mol
LogP3.71
Rot. Bonds5

About 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid

2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid (PubChem CID 81282204) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid.

Molecular Properties

Compound Name2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid
PubChem CID81282204
Molecular FormulaC14H16N2O2S
Molecular Weight276.36 g/mol
Exact Mass276.09
IUPAC Name2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid
SMILESCCC(Nc1ccc(C(=O)O)c(C)c1)c1nccs1
InChIInChI=1S/C14H16N2O2S/c1-3-12(13-15-6-7-19-13)16-10-4-5-11(14(17)18)9(2)8-10/h4-8,12,16H,3H2,1-2H3,(H,17,18)
InChIKeyPZCRFVRVMNRTJL-UHFFFAOYSA-N
XLogP3.71
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.36
LogP ≤ 53.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid?
The IUPAC name of 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid (CID 81282204) is 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid.
What is the SMILES notation for 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid?
The canonical SMILES for 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid is CCC(Nc1ccc(C(=O)O)c(C)c1)c1nccs1.
What is the InChIKey of 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid?
The InChIKey is PZCRFVRVMNRTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-3-12(13-15-6-7-19-13)16-10-4-5-11(14(17)18)9(2)8-10/h4-8,12,16H,3H2,1-2H3,(H,17,18).
What are the key properties of 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid?
2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid has a molecular weight of 276.36 g/mol, XLogP of 3.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[1-(1,3-thiazol-2-yl)propylamino]benzoic acid is sourced from PubChem (CID 81282204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).