C15H20ClNO2S — CID 103289705
1-amino-2-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]cyclopentane-1-carboxylic acid (PubChem CID 103289705) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 1-amino-2-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-amino-2-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103289705 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-amino-2-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]cyclopentane-1-carboxylic acid |
| SMILES | NC1(C(=O)O)CCCC1CCSCc1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO2S/c16-13-6-2-1-4-11(13)10-20-9-7-12-5-3-8-15(12,17)14(18)19/h1-2,4,6,12H,3,5,7-10,17H2,(H,18,19) |
| InChIKey | ONLDITZNRYOYFQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|