C15H24ClNOS — CID 103290329
2-[(2-chlorophenyl)methylsulfinyl]-N-propylpentan-3-amine (PubChem CID 103290329) has the molecular formula C15H24ClNOS and a molecular weight of 301.88 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfinyl]-N-propylpentan-3-amine.
| Compound Name | 2-[(2-chlorophenyl)methylsulfinyl]-N-propylpentan-3-amine |
|---|---|
| PubChem CID | 103290329 |
| Molecular Formula | C15H24ClNOS |
| Molecular Weight | 301.88 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfinyl]-N-propylpentan-3-amine |
| SMILES | CCCNC(CC)C(C)S(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C15H24ClNOS/c1-4-10-17-15(5-2)12(3)19(18)11-13-8-6-7-9-14(13)16/h6-9,12,15,17H,4-5,10-11H2,1-3H3 |
| InChIKey | OMYDLYLURJSRTD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.88 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |