C16H26ClNOS — CID 64659442
3-(2-chlorophenyl)sulfinyl-N-propylheptan-4-amine (PubChem CID 64659442) has the molecular formula C16H26ClNOS and a molecular weight of 315.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfinyl-N-propylheptan-4-amine.
| Compound Name | 3-(2-chlorophenyl)sulfinyl-N-propylheptan-4-amine |
|---|---|
| PubChem CID | 64659442 |
| Molecular Formula | C16H26ClNOS |
| Molecular Weight | 315.91 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(2-chlorophenyl)sulfinyl-N-propylheptan-4-amine |
| SMILES | CCCNC(CCC)C(CC)S(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H26ClNOS/c1-4-9-14(18-12-5-2)15(6-3)20(19)16-11-8-7-10-13(16)17/h7-8,10-11,14-15,18H,4-6,9,12H2,1-3H3 |
| InChIKey | XIBRYRSXSPRDFV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |