C11H11ClN4O3S — CID 103293100
2-[1-[(2-chloro-6-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetic acid (PubChem CID 103293100) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is 2-[1-[(2-chloro-6-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[(2-chloro-6-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 103293100 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-[1-[(2-chloro-6-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetic acid |
| SMILES | COc1cccc(Cl)c1Cn1nnnc1SCC(=O)O |
| InChI | InChI=1S/C11H11ClN4O3S/c1-19-9-4-2-3-8(12)7(9)5-16-11(13-14-15-16)20-6-10(17)18/h2-4H,5-6H2,1H3,(H,17,18) |
| InChIKey | ODYIYGXCHXRAJT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |