C15H20FN3 — CID 103295052
N-(3,3-dimethylcyclohexyl)-6-fluoro-1H-benzimidazol-2-amine (PubChem CID 103295052) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is N-(3,3-dimethylcyclohexyl)-6-fluoro-1H-benzimidazol-2-amine.
| Compound Name | N-(3,3-dimethylcyclohexyl)-6-fluoro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103295052 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-(3,3-dimethylcyclohexyl)-6-fluoro-1H-benzimidazol-2-amine |
| SMILES | CC1(C)CCCC(Nc2nc3ccc(F)cc3[nH]2)C1 |
| InChI | InChI=1S/C15H20FN3/c1-15(2)7-3-4-11(9-15)17-14-18-12-6-5-10(16)8-13(12)19-14/h5-6,8,11H,3-4,7,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | XUYVBGJXEYBBSE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |