C15H21FN4 — CID 103295345
1-cyclohexyl-N-(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diamine (PubChem CID 103295345) has the molecular formula C15H21FN4 and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-cyclohexyl-N-(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N-(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103295345 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-cyclohexyl-N-(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diamine |
| SMILES | NCC(Nc1nc2ccc(F)cc2[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C15H21FN4/c16-11-6-7-12-13(8-11)19-15(18-12)20-14(9-17)10-4-2-1-3-5-10/h6-8,10,14H,1-5,9,17H2,(H2,18,19,20) |
| InChIKey | YUTJIPZYTNIGJH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |