C14H23N3O3S — CID 103304816
2-(2,2-dimethylmorpholin-4-yl)sulfonyl-N-propylpyridin-3-amine (PubChem CID 103304816) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)sulfonyl-N-propylpyridin-3-amine.
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)sulfonyl-N-propylpyridin-3-amine |
|---|---|
| PubChem CID | 103304816 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)sulfonyl-N-propylpyridin-3-amine |
| SMILES | CCCNc1cccnc1S(=O)(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H23N3O3S/c1-4-7-15-12-6-5-8-16-13(12)21(18,19)17-9-10-20-14(2,3)11-17/h5-6,8,15H,4,7,9-11H2,1-3H3 |
| InChIKey | FJJKCDIZPDQNDL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |