C14H23N3O3S — CID 103306620
4-methyl-1-[[3-(propylamino)-2-pyridinyl]sulfonyl]piperidin-4-ol (PubChem CID 103306620) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-methyl-1-[[3-(propylamino)-2-pyridinyl]sulfonyl]piperidin-4-ol.
| Compound Name | 4-methyl-1-[[3-(propylamino)-2-pyridinyl]sulfonyl]piperidin-4-ol |
|---|---|
| PubChem CID | 103306620 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-methyl-1-[[3-(propylamino)-2-pyridinyl]sulfonyl]piperidin-4-ol |
| SMILES | CCCNc1cccnc1S(=O)(=O)N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-8-15-12-5-4-9-16-13(12)21(19,20)17-10-6-14(2,18)7-11-17/h4-5,9,15,18H,3,6-8,10-11H2,1-2H3 |
| InChIKey | MRZRXOOUJWBSHK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |