About [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene
[(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene (PubChem CID 10330697) has the molecular formula C12H16OS
and a molecular weight of 208.33 g/mol. Its IUPAC name is [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene.
Molecular Properties
| Compound Name | [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene |
| PubChem CID | 10330697 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene |
| SMILES | CC(C)(C)/C=C/S(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16OS/c1-12(2,3)9-10-14(13)11-7-5-4-6-8-11/h4-10H,1-3H3/b10-9+ |
| InChIKey | ZTCJPDRBRJFKQU-MDZDMXLPSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene?
The IUPAC name of [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene (CID 10330697) is [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene.
What is the SMILES notation for [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene?
The canonical SMILES for [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene is CC(C)(C)/C=C/S(=O)c1ccccc1.
What is the InChIKey of [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene?
The InChIKey is ZTCJPDRBRJFKQU-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H16OS/c1-12(2,3)9-10-14(13)11-7-5-4-6-8-11/h4-10H,1-3H3/b10-9+.
What are the key properties of [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene?
[(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene has a molecular weight of 208.33 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3,3-dimethylbut-1-enyl]sulfinylbenzene is sourced from PubChem (CID 10330697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).