C6H6F6N4 — CID 103309486
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-1,2,4-triazol-3-amine (PubChem CID 103309486) has the molecular formula C6H6F6N4 and a molecular weight of 248.13 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 103309486 |
| Molecular Formula | C6H6F6N4 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(C(C(F)(F)F)C(F)(F)F)nc1N |
| InChI | InChI=1S/C6H6F6N4/c1-16-4(13)14-3(15-16)2(5(7,8)9)6(10,11)12/h2H,1H3,(H2,13,14,15) |
| InChIKey | LRLMNRAGLGGGEM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |