C16H32N4 — CID 170424488
2-methyl-5-tridecan-7-yl-1,2,4-triazol-3-amine (PubChem CID 170424488) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-methyl-5-tridecan-7-yl-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-5-tridecan-7-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 170424488 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 2-methyl-5-tridecan-7-yl-1,2,4-triazol-3-amine |
| SMILES | CCCCCCC(CCCCCC)c1nc(N)n(C)n1 |
| InChI | InChI=1S/C16H32N4/c1-4-6-8-10-12-14(13-11-9-7-5-2)15-18-16(17)20(3)19-15/h14H,4-13H2,1-3H3,(H2,17,18,19) |
| InChIKey | XMIFWSJYNDWMRW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|