About 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole
2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole (PubChem CID 10331102) has the molecular formula C11H15N3S
and a molecular weight of 221.33 g/mol. Its IUPAC name is 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole |
| PubChem CID | 10331102 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole |
| SMILES | CCc1nc(Cc2cnc[nH]2)c(CC)s1 |
| InChI | InChI=1S/C11H15N3S/c1-3-10-9(14-11(4-2)15-10)5-8-6-12-7-13-8/h6-7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | HMDJOEKJUSVSEM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole?
The IUPAC name of 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole (CID 10331102) is 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole.
What is the SMILES notation for 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole?
The canonical SMILES for 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole is CCc1nc(Cc2cnc[nH]2)c(CC)s1.
What is the InChIKey of 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole?
The InChIKey is HMDJOEKJUSVSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S/c1-3-10-9(14-11(4-2)15-10)5-8-6-12-7-13-8/h6-7H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole?
2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole has a molecular weight of 221.33 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diethyl-4-(1H-imidazol-5-ylmethyl)-1,3-thiazole is sourced from PubChem (CID 10331102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).