C9H11N3S — CID 10559697
4-(1H-imidazol-5-ylmethyl)-2,5-dimethyl-1,3-thiazole (PubChem CID 10559697) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 4-(1H-imidazol-5-ylmethyl)-2,5-dimethyl-1,3-thiazole.
| Compound Name | 4-(1H-imidazol-5-ylmethyl)-2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 10559697 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-(1H-imidazol-5-ylmethyl)-2,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(Cc2cnc[nH]2)c(C)s1 |
| InChI | InChI=1S/C9H11N3S/c1-6-9(12-7(2)13-6)3-8-4-10-5-11-8/h4-5H,3H2,1-2H3,(H,10,11) |
| InChIKey | VUQCASYMUPNGSV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |