C12H17N3S — CID 10513932
2,5-diethyl-4-[1-(1H-imidazol-5-yl)ethyl]-1,3-thiazole (PubChem CID 10513932) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 2,5-diethyl-4-[1-(1H-imidazol-5-yl)ethyl]-1,3-thiazole.
| Compound Name | 2,5-diethyl-4-[1-(1H-imidazol-5-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 10513932 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2,5-diethyl-4-[1-(1H-imidazol-5-yl)ethyl]-1,3-thiazole |
| SMILES | CCc1nc(C(C)c2cnc[nH]2)c(CC)s1 |
| InChI | InChI=1S/C12H17N3S/c1-4-10-12(15-11(5-2)16-10)8(3)9-6-13-7-14-9/h6-8H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | CCHUDGDIMFXMNF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |