C10H17F6N — CID 103311819
1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)octan-3-amine (PubChem CID 103311819) has the molecular formula C10H17F6N and a molecular weight of 265.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)octan-3-amine.
| Compound Name | 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)octan-3-amine |
|---|---|
| PubChem CID | 103311819 |
| Molecular Formula | C10H17F6N |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1,1,1-trifluoro-N-methyl-2-(trifluoromethyl)octan-3-amine |
| SMILES | CCCCCC(NC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6N/c1-3-4-5-6-7(17-2)8(9(11,12)13)10(14,15)16/h7-8,17H,3-6H2,1-2H3 |
| InChIKey | URJWPDCTYPEHSP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|