About N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine
N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine (PubChem CID 103311999) has the molecular formula C11H17F6N
and a molecular weight of 277.25 g/mol. Its IUPAC name is N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine.
Molecular Properties
| Compound Name | N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine |
| PubChem CID | 103311999 |
| Molecular Formula | C11H17F6N |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine |
| SMILES | C=CCCCC(NCC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6N/c1-3-5-6-7-8(18-4-2)9(10(12,13)14)11(15,16)17/h3,8-9,18H,1,4-7H2,2H3 |
| InChIKey | CARQUWOWZJPINT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine?
The IUPAC name of N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine (CID 103311999) is N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine.
What is the SMILES notation for N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine?
The canonical SMILES for N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine is C=CCCCC(NCC)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine?
The InChIKey is CARQUWOWZJPINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F6N/c1-3-5-6-7-8(18-4-2)9(10(12,13)14)11(15,16)17/h3,8-9,18H,1,4-7H2,2H3.
What are the key properties of N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine?
N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine has a molecular weight of 277.25 g/mol, XLogP of 4.06, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine is sourced from PubChem (CID 103311999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).