C11H17F6N — CID 103311999
N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine (PubChem CID 103311999) has the molecular formula C11H17F6N and a molecular weight of 277.25 g/mol. Its IUPAC name is N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine.
| Compound Name | N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine |
|---|---|
| PubChem CID | 103311999 |
| Molecular Formula | C11H17F6N |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)oct-7-en-3-amine |
| SMILES | C=CCCCC(NCC)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6N/c1-3-5-6-7-8(18-4-2)9(10(12,13)14)11(15,16)17/h3,8-9,18H,1,4-7H2,2H3 |
| InChIKey | CARQUWOWZJPINT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|