C15H22N2O2 — CID 103313115
3-(3-ethoxypropylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103313115) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-(3-ethoxypropylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(3-ethoxypropylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103313115 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-(3-ethoxypropylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CCOCCCNC1CCc2ccccc2NC1=O |
| InChI | InChI=1S/C15H22N2O2/c1-2-19-11-5-10-16-14-9-8-12-6-3-4-7-13(12)17-15(14)18/h3-4,6-7,14,16H,2,5,8-11H2,1H3,(H,17,18) |
| InChIKey | FLESOEYOMGEPEG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|