C15H22N2O2 — CID 107317427
3-(5-hydroxypentylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 107317427) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-(5-hydroxypentylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-(5-hydroxypentylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 107317427 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-(5-hydroxypentylamino)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CCC1NCCCCCO |
| InChI | InChI=1S/C15H22N2O2/c18-11-5-1-4-10-16-14-9-8-12-6-2-3-7-13(12)17-15(14)19/h2-3,6-7,14,16,18H,1,4-5,8-11H2,(H,17,19) |
| InChIKey | RRRWRZQCBSXDMJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|