(Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid

C12H20O4 — CID 10331360

IUPAC(Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid
SMILESCC1(C)OC[C@H](/C=C\CCCCC(=O)O)O1
InChIInChI=1S/C12H20O4/c1-12(2)15-9-10(16-12)7-5-3-4-6-8-11(13)14/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,13,14)/b7-5-/t10-/m0/s1
InChIKeyUECHTXUTBZVLJM-BXKUYDPTSA-N
MW228.29 g/mol
LogP2.34
Rot. Bonds6

About (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid

(Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid (PubChem CID 10331360) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid.

Molecular Properties

Compound Name(Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid
PubChem CID10331360
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name(Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid
SMILESCC1(C)OC[C@H](/C=C\CCCCC(=O)O)O1
InChIInChI=1S/C12H20O4/c1-12(2)15-9-10(16-12)7-5-3-4-6-8-11(13)14/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,13,14)/b7-5-/t10-/m0/s1
InChIKeyUECHTXUTBZVLJM-BXKUYDPTSA-N
XLogP2.34
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid?
The IUPAC name of (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid (CID 10331360) is (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid.
What is the SMILES notation for (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid?
The canonical SMILES for (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid is CC1(C)OC[C@H](/C=C\CCCCC(=O)O)O1.
What is the InChIKey of (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid?
The InChIKey is UECHTXUTBZVLJM-BXKUYDPTSA-N. The full InChI is InChI=1S/C12H20O4/c1-12(2)15-9-10(16-12)7-5-3-4-6-8-11(13)14/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,13,14)/b7-5-/t10-/m0/s1.
What are the key properties of (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid?
(Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid has a molecular weight of 228.29 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-enoic acid is sourced from PubChem (CID 10331360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).