C12H18N4 — CID 103316187
(2-pentan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)methanamine (PubChem CID 103316187) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2-pentan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)methanamine.
| Compound Name | (2-pentan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)methanamine |
|---|---|
| PubChem CID | 103316187 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (2-pentan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)methanamine |
| SMILES | CCCC(C)c1cc2nccc(CN)n2n1 |
| InChI | InChI=1S/C12H18N4/c1-3-4-9(2)11-7-12-14-6-5-10(8-13)16(12)15-11/h5-7,9H,3-4,8,13H2,1-2H3 |
| InChIKey | XSUIWCHFCREISE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |