C11H13F3N4S — CID 103329359
6-methyl-4-N-(4,4,4-trifluorobutyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103329359) has the molecular formula C11H13F3N4S and a molecular weight of 290.31 g/mol. Its IUPAC name is 6-methyl-4-N-(4,4,4-trifluorobutyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(4,4,4-trifluorobutyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103329359 |
| Molecular Formula | C11H13F3N4S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 6-methyl-4-N-(4,4,4-trifluorobutyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cc2c(NCCCC(F)(F)F)nc(N)nc2s1 |
| InChI | InChI=1S/C11H13F3N4S/c1-6-5-7-8(16-4-2-3-11(12,13)14)17-10(15)18-9(7)19-6/h5H,2-4H2,1H3,(H3,15,16,17,18) |
| InChIKey | HSHKWYFYOIOVPC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|