C11H12F3N3OS — CID 103333279
6-methyl-4-(4,4,4-trifluorobutoxy)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103333279) has the molecular formula C11H12F3N3OS and a molecular weight of 291.30 g/mol. Its IUPAC name is 6-methyl-4-(4,4,4-trifluorobutoxy)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-methyl-4-(4,4,4-trifluorobutoxy)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103333279 |
| Molecular Formula | C11H12F3N3OS |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 6-methyl-4-(4,4,4-trifluorobutoxy)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cc2c(OCCCC(F)(F)F)nc(N)nc2s1 |
| InChI | InChI=1S/C11H12F3N3OS/c1-6-5-7-8(16-10(15)17-9(7)19-6)18-4-2-3-11(12,13)14/h5H,2-4H2,1H3,(H2,15,16,17) |
| InChIKey | MTTXBQNAXGGGJR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|