C13H21N5S — CID 103329501
4-(2,2-dimethylhydrazinyl)-6-ethyl-N-propylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103329501) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-6-ethyl-N-propylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-6-ethyl-N-propylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103329501 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-6-ethyl-N-propylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCNc1nc(NN(C)C)c2cc(CC)sc2n1 |
| InChI | InChI=1S/C13H21N5S/c1-5-7-14-13-15-11(17-18(3)4)10-8-9(6-2)19-12(10)16-13/h8H,5-7H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | VFCUAUMQWIDNMI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|