C11H10IN5S — CID 103331139
4-(4-iodopyrazol-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103331139) has the molecular formula C11H10IN5S and a molecular weight of 371.21 g/mol. Its IUPAC name is 4-(4-iodopyrazol-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(4-iodopyrazol-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103331139 |
| Molecular Formula | C11H10IN5S |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 4-(4-iodopyrazol-1-yl)-N,6-dimethylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(-n2cc(I)cn2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C11H10IN5S/c1-6-3-8-9(17-5-7(12)4-14-17)15-11(13-2)16-10(8)18-6/h3-5H,1-2H3,(H,13,15,16) |
| InChIKey | WWDKNEKNEHFRNK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|