C12H14F3N5S — CID 103333103
N-cyclopropyl-2-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103333103) has the molecular formula C12H14F3N5S and a molecular weight of 317.34 g/mol. Its IUPAC name is N-cyclopropyl-2-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-2-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103333103 |
| Molecular Formula | C12H14F3N5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-cyclopropyl-2-hydrazinyl-6-methyl-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(N(CC(F)(F)F)C3CC3)nc(NN)nc2s1 |
| InChI | InChI=1S/C12H14F3N5S/c1-6-4-8-9(17-11(19-16)18-10(8)21-6)20(7-2-3-7)5-12(13,14)15/h4,7H,2-3,5,16H2,1H3,(H,17,18,19) |
| InChIKey | LSYMHEQFVWNGPW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|