C13H21N5OS — CID 103334672
3-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]pentan-1-ol (PubChem CID 103334672) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]pentan-1-ol.
| Compound Name | 3-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]pentan-1-ol |
|---|---|
| PubChem CID | 103334672 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-[[(2-hydrazinyl-6-methylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]pentan-1-ol |
| SMILES | CCC(CCO)CNc1nc(NN)nc2sc(C)cc12 |
| InChI | InChI=1S/C13H21N5OS/c1-3-9(4-5-19)7-15-11-10-6-8(2)20-12(10)17-13(16-11)18-14/h6,9,19H,3-5,7,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | KOIARBYAAFLLKO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|