C13H17N3OS2 — CID 103334914
6-ethyl-4-(oxan-4-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103334914) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 6-ethyl-4-(oxan-4-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-ethyl-4-(oxan-4-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103334914 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 6-ethyl-4-(oxan-4-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCc1cc2c(SC3CCOCC3)nc(N)nc2s1 |
| InChI | InChI=1S/C13H17N3OS2/c1-2-8-7-10-11(18-8)15-13(14)16-12(10)19-9-3-5-17-6-4-9/h7,9H,2-6H2,1H3,(H2,14,15,16) |
| InChIKey | HDEGAHOFGHSSIW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |