C11H10N4S3 — CID 103334605
6-ethyl-4-(1,3-thiazol-2-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 103334605) has the molecular formula C11H10N4S3 and a molecular weight of 294.43 g/mol. Its IUPAC name is 6-ethyl-4-(1,3-thiazol-2-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-ethyl-4-(1,3-thiazol-2-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103334605 |
| Molecular Formula | C11H10N4S3 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 6-ethyl-4-(1,3-thiazol-2-ylsulfanyl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCc1cc2c(Sc3nccs3)nc(N)nc2s1 |
| InChI | InChI=1S/C11H10N4S3/c1-2-6-5-7-8(17-6)14-10(12)15-9(7)18-11-13-3-4-16-11/h3-5H,2H2,1H3,(H2,12,14,15) |
| InChIKey | WSDLYZXNXNKBCO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|