C16H22O2Si — CID 10333577
1-prop-1-ynyl-4-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol (PubChem CID 10333577) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is 1-prop-1-ynyl-4-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol.
| Compound Name | 1-prop-1-ynyl-4-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10333577 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-prop-1-ynyl-4-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol |
| SMILES | CC#CC1(O)CCC(O)(C#CC#C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C16H22O2Si/c1-5-8-15(17)10-12-16(18,13-11-15)9-6-7-14-19(2,3)4/h17-18H,10-13H2,1-4H3 |
| InChIKey | XVQWSKVKUGXVCA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|