C13H20O2Si — CID 10466659
1-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol (PubChem CID 10466659) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is 1-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol.
| Compound Name | 1-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10466659 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(4-trimethylsilylbuta-1,3-diynyl)cyclohexane-1,4-diol |
| SMILES | C[Si](C)(C)C#CC#CC1(O)CCC(O)CC1 |
| InChI | InChI=1S/C13H20O2Si/c1-16(2,3)11-5-4-8-13(15)9-6-12(14)7-10-13/h12,14-15H,6-7,9-10H2,1-3H3 |
| InChIKey | AKRIRAKXCBWOOM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|