C12H24O2Si — CID 102227332
(2R,4R)-2,4-dimethyl-7-trimethylsilylhept-6-yne-1,4-diol (PubChem CID 102227332) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is (2R,4R)-2,4-dimethyl-7-trimethylsilylhept-6-yne-1,4-diol.
| Compound Name | (2R,4R)-2,4-dimethyl-7-trimethylsilylhept-6-yne-1,4-diol |
|---|---|
| PubChem CID | 102227332 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2R,4R)-2,4-dimethyl-7-trimethylsilylhept-6-yne-1,4-diol |
| SMILES | C[C@@H](CO)C[C@@](C)(O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2Si/c1-11(10-13)9-12(2,14)7-6-8-15(3,4)5/h11,13-14H,7,9-10H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | OKPDIVXPSWWOHI-NEPJUHHUSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|