C18H30F2OSi3 — CID 54590419
4,4-difluoro-1,7-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)hepta-1,6-diyn-3-ol (PubChem CID 54590419) has the molecular formula C18H30F2OSi3 and a molecular weight of 384.69 g/mol. Its IUPAC name is 4,4-difluoro-1,7-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)hepta-1,6-diyn-3-ol.
| Compound Name | 4,4-difluoro-1,7-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)hepta-1,6-diyn-3-ol |
|---|---|
| PubChem CID | 54590419 |
| Molecular Formula | C18H30F2OSi3 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4,4-difluoro-1,7-bis(trimethylsilyl)-3-(2-trimethylsilylethynyl)hepta-1,6-diyn-3-ol |
| SMILES | C[Si](C)(C)C#CCC(F)(F)C(O)(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H30F2OSi3/c1-22(2,3)14-10-11-18(19,20)17(21,12-15-23(4,5)6)13-16-24(7,8)9/h21H,11H2,1-9H3 |
| InChIKey | VWNIFNNMLIKHKX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|