C16H28O2Si2 — CID 10902927
1,4-bis(2-trimethylsilylethynyl)cyclohexane-1,4-diol (PubChem CID 10902927) has the molecular formula C16H28O2Si2 and a molecular weight of 308.57 g/mol. Its IUPAC name is 1,4-bis(2-trimethylsilylethynyl)cyclohexane-1,4-diol.
| Compound Name | 1,4-bis(2-trimethylsilylethynyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10902927 |
| Molecular Formula | C16H28O2Si2 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1,4-bis(2-trimethylsilylethynyl)cyclohexane-1,4-diol |
| SMILES | C[Si](C)(C)C#CC1(O)CCC(O)(C#C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C16H28O2Si2/c1-19(2,3)13-11-15(17)7-9-16(18,10-8-15)12-14-20(4,5)6/h17-18H,7-10H2,1-6H3 |
| InChIKey | OSPFQFVVXBMDTB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|