C13H23N3O4S — CID 103340608
1-(2-hydroxyethyl)-N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enylpyrazole-4-sulfonamide (PubChem CID 103340608) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enylpyrazole-4-sulfonamide.
| Compound Name | 1-(2-hydroxyethyl)-N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 103340608 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-(2-methoxyethyl)-3,5-dimethyl-N-prop-2-enylpyrazole-4-sulfonamide |
| SMILES | C=CCN(CCOC)S(=O)(=O)c1c(C)nn(CCO)c1C |
| InChI | InChI=1S/C13H23N3O4S/c1-5-6-15(8-10-20-4)21(18,19)13-11(2)14-16(7-9-17)12(13)3/h5,17H,1,6-10H2,2-4H3 |
| InChIKey | WRDDWDYUJVMQPP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|