C15H16N4O2 — CID 10334065
3-(5-methoxy-2-propan-2-yloxyphenyl)triazolo[4,5-b]pyridine (PubChem CID 10334065) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-(5-methoxy-2-propan-2-yloxyphenyl)triazolo[4,5-b]pyridine.
| Compound Name | 3-(5-methoxy-2-propan-2-yloxyphenyl)triazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 10334065 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-(5-methoxy-2-propan-2-yloxyphenyl)triazolo[4,5-b]pyridine |
| SMILES | COc1ccc(OC(C)C)c(-n2nnc3cccnc32)c1 |
| InChI | InChI=1S/C15H16N4O2/c1-10(2)21-14-7-6-11(20-3)9-13(14)19-15-12(17-18-19)5-4-8-16-15/h4-10H,1-3H3 |
| InChIKey | KVRFFSOPCPFFEL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |