C18H23N3O2Si — CID 71658682
[3-(2,5-dimethoxyphenyl)-6-methylbenzotriazol-4-yl]-trimethylsilane (PubChem CID 71658682) has the molecular formula C18H23N3O2Si and a molecular weight of 341.49 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)-6-methylbenzotriazol-4-yl]-trimethylsilane.
| Compound Name | [3-(2,5-dimethoxyphenyl)-6-methylbenzotriazol-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 71658682 |
| Molecular Formula | C18H23N3O2Si |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)-6-methylbenzotriazol-4-yl]-trimethylsilane |
| SMILES | COc1ccc(OC)c(-n2nnc3cc(C)cc([Si](C)(C)C)c32)c1 |
| InChI | InChI=1S/C18H23N3O2Si/c1-12-9-14-18(17(10-12)24(4,5)6)21(20-19-14)15-11-13(22-2)7-8-16(15)23-3/h7-11H,1-6H3 |
| InChIKey | ADWICBXURLOMIY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|