C14H20N6O — CID 103341824
4-morpholin-4-yl-N-propyl-6-(1H-pyrrol-2-yl)-1,3,5-triazin-2-amine (PubChem CID 103341824) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-propyl-6-(1H-pyrrol-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-N-propyl-6-(1H-pyrrol-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103341824 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 4-morpholin-4-yl-N-propyl-6-(1H-pyrrol-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCNc1nc(-c2ccc[nH]2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H20N6O/c1-2-5-16-13-17-12(11-4-3-6-15-11)18-14(19-13)20-7-9-21-10-8-20/h3-4,6,15H,2,5,7-10H2,1H3,(H,16,17,18,19) |
| InChIKey | BGLOUAFQQVLKNH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |