C12H15BrN2O4S — CID 103342296
methyl 2-[(5-bromo-2-pyridinyl)sulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103342296) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-pyridinyl)sulfamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[(5-bromo-2-pyridinyl)sulfamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103342296 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | methyl 2-[(5-bromo-2-pyridinyl)sulfamoyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H15BrN2O4S/c1-19-12(16)9-3-2-4-10(9)20(17,18)15-11-6-5-8(13)7-14-11/h5-7,9-10H,2-4H2,1H3,(H,14,15) |
| InChIKey | APWFTQQGEHFJSB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |