C11H15NO4S2 — CID 103343173
methyl 2-(thiophen-3-ylsulfamoyl)cyclopentane-1-carboxylate (PubChem CID 103343173) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 2-(thiophen-3-ylsulfamoyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-(thiophen-3-ylsulfamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343173 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl 2-(thiophen-3-ylsulfamoyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)Nc1ccsc1 |
| InChI | InChI=1S/C11H15NO4S2/c1-16-11(13)9-3-2-4-10(9)18(14,15)12-8-5-6-17-7-8/h5-7,9-10,12H,2-4H2,1H3 |
| InChIKey | DCKRNPRDJUHOIY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |