C13H15BrClNO4S — CID 103343259
methyl 2-[(2-bromo-5-chlorophenyl)sulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103343259) has the molecular formula C13H15BrClNO4S and a molecular weight of 396.69 g/mol. Its IUPAC name is methyl 2-[(2-bromo-5-chlorophenyl)sulfamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[(2-bromo-5-chlorophenyl)sulfamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343259 |
| Molecular Formula | C13H15BrClNO4S |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | methyl 2-[(2-bromo-5-chlorophenyl)sulfamoyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1S(=O)(=O)Nc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C13H15BrClNO4S/c1-20-13(17)9-3-2-4-12(9)21(18,19)16-11-7-8(15)5-6-10(11)14/h5-7,9,12,16H,2-4H2,1H3 |
| InChIKey | MHZXNESBCMFWJU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |