C13H21NO4S — CID 103343312
methyl 2-[cyclopropyl(prop-2-enyl)sulfamoyl]cyclopentane-1-carboxylate (PubChem CID 103343312) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is methyl 2-[cyclopropyl(prop-2-enyl)sulfamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[cyclopropyl(prop-2-enyl)sulfamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 103343312 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 2-[cyclopropyl(prop-2-enyl)sulfamoyl]cyclopentane-1-carboxylate |
| SMILES | C=CCN(C1CC1)S(=O)(=O)C1CCCC1C(=O)OC |
| InChI | InChI=1S/C13H21NO4S/c1-3-9-14(10-7-8-10)19(16,17)12-6-4-5-11(12)13(15)18-2/h3,10-12H,1,4-9H2,2H3 |
| InChIKey | AUOBOTYUOITTEM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|