C17H25NO3 — CID 10334473
2-[(3aS,4R,5S,9bR)-5-(hydroxymethyl)-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]acetonitrile (PubChem CID 10334473) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[(3aS,4R,5S,9bR)-5-(hydroxymethyl)-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]acetonitrile.
| Compound Name | 2-[(3aS,4R,5S,9bR)-5-(hydroxymethyl)-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 10334473 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[(3aS,4R,5S,9bR)-5-(hydroxymethyl)-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]acetonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C1=C(CCCC1)[C@@](C)(CO)[C@H]2CC#N |
| InChI | InChI=1S/C17H25NO3/c1-16(2)20-14-11-6-4-5-7-12(11)17(3,10-19)13(8-9-18)15(14)21-16/h13-15,19H,4-8,10H2,1-3H3/t13-,14+,15-,17+/m0/s1 |
| InChIKey | SWOZOGLPTIDILY-QSJFSLAZSA-N |
| XLogP | 2.92 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|