C11H14BrNO2 — CID 53465879
2-[(3aS,5S,7aS)-7-bromo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]acetonitrile (PubChem CID 53465879) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-[(3aS,5S,7aS)-7-bromo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]acetonitrile.
| Compound Name | 2-[(3aS,5S,7aS)-7-bromo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 53465879 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[(3aS,5S,7aS)-7-bromo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]acetonitrile |
| SMILES | CC1(C)O[C@H]2C[C@H](CC#N)C=C(Br)[C@H]2O1 |
| InChI | InChI=1S/C11H14BrNO2/c1-11(2)14-9-6-7(3-4-13)5-8(12)10(9)15-11/h5,7,9-10H,3,6H2,1-2H3/t7-,9+,10-/m1/s1 |
| InChIKey | MQLBJMXPLABYLO-FKTZTGRPSA-N |
| XLogP | 2.72 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |