C12H15NOS2 — CID 103344738
(5,6-dimethyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone (PubChem CID 103344738) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (5,6-dimethyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone.
| Compound Name | (5,6-dimethyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 103344738 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (5,6-dimethyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone |
| SMILES | CC1SCC(C(=O)c2cccnc2)SC1C |
| InChI | InChI=1S/C12H15NOS2/c1-8-9(2)16-11(7-15-8)12(14)10-4-3-5-13-6-10/h3-6,8-9,11H,7H2,1-2H3 |
| InChIKey | WQTMLIYHQMUYSS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |