C11H13NOS2 — CID 115385690
(3-methyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone (PubChem CID 115385690) has the molecular formula C11H13NOS2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (3-methyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone.
| Compound Name | (3-methyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 115385690 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (3-methyl-1,4-dithian-2-yl)-pyridin-3-ylmethanone |
| SMILES | CC1SCCSC1C(=O)c1cccnc1 |
| InChI | InChI=1S/C11H13NOS2/c1-8-11(15-6-5-14-8)10(13)9-3-2-4-12-7-9/h2-4,7-8,11H,5-6H2,1H3 |
| InChIKey | QLNVCDXROUKJJG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |