C14H13NO3 — CID 58332847
3-(pyridine-3-carbonyl)bicyclo[3.2.1]octane-2,4-dione (PubChem CID 58332847) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-(pyridine-3-carbonyl)bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(pyridine-3-carbonyl)bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 58332847 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-(pyridine-3-carbonyl)bicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C(c1cccnc1)C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C14H13NO3/c16-12-8-3-4-9(6-8)13(17)11(12)14(18)10-2-1-5-15-7-10/h1-2,5,7-9,11H,3-4,6H2 |
| InChIKey | IPJMJLSGEHCUDJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|