C11H12N2O — CID 141122690
pyridin-3-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone (PubChem CID 141122690) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is pyridin-3-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone.
| Compound Name | pyridin-3-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone |
|---|---|
| PubChem CID | 141122690 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | pyridin-3-yl(1,2,3,4-tetrahydropyridin-2-yl)methanone |
| SMILES | O=C(c1cccnc1)C1CCC=CN1 |
| InChI | InChI=1S/C11H12N2O/c14-11(9-4-3-6-12-8-9)10-5-1-2-7-13-10/h2-4,6-8,10,13H,1,5H2 |
| InChIKey | YFGQDEHHBMSQLL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |